C18H16Br2N4O2S — CID 6408360
(6S)-3-butylsulfanyl-6-(4,5-dibromofuran-2-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 6408360) has the molecular formula C18H16Br2N4O2S and a molecular weight of 512.23 g/mol. Its IUPAC name is (6S)-3-butylsulfanyl-6-(4,5-dibromofuran-2-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6S)-3-butylsulfanyl-6-(4,5-dibromofuran-2-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 6408360 |
| Molecular Formula | C18H16Br2N4O2S |
| Molecular Weight | 512.23 g/mol |
| Exact Mass | 509.94 |
| IUPAC Name | (6S)-3-butylsulfanyl-6-(4,5-dibromofuran-2-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCCCSc1nnc2c(n1)O[C@@H](c1cc(Br)c(Br)o1)Nc1ccccc1-2 |
| InChI | InChI=1S/C18H16Br2N4O2S/c1-2-3-8-27-18-22-17-14(23-24-18)10-6-4-5-7-12(10)21-16(26-17)13-9-11(19)15(20)25-13/h4-7,9,16,21H,2-3,8H2,1H3/t16-/m0/s1 |
| InChIKey | XZEPJLFUVXEKJJ-INIZCTEOSA-N |
| XLogP | 6.05 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.23 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|