C20H17Br3N4O2S — CID 6410159
2,4,6-tribromo-3-(3-butylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol (PubChem CID 6410159) has the molecular formula C20H17Br3N4O2S and a molecular weight of 617.16 g/mol. Its IUPAC name is 2,4,6-tribromo-3-(3-butylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol.
| Compound Name | 2,4,6-tribromo-3-(3-butylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol |
|---|---|
| PubChem CID | 6410159 |
| Molecular Formula | C20H17Br3N4O2S |
| Molecular Weight | 617.16 g/mol |
| Exact Mass | 613.86 |
| IUPAC Name | 2,4,6-tribromo-3-(3-butylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol |
| SMILES | CCCCSc1nnc2c(n1)OC(c1c(Br)cc(Br)c(O)c1Br)Nc1ccccc1-2 |
| InChI | InChI=1S/C20H17Br3N4O2S/c1-2-3-8-30-20-25-19-16(26-27-20)10-6-4-5-7-13(10)24-18(29-19)14-11(21)9-12(22)17(28)15(14)23/h4-7,9,18,24,28H,2-3,8H2,1H3 |
| InChIKey | QYJAHFXGEUELAC-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.16 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|