About 3-ethoxyisoquinoline
3-ethoxyisoquinoline (PubChem CID 640966) has the molecular formula C11H11NO
and a molecular weight of 173.21 g/mol. Its IUPAC name is 3-ethoxyisoquinoline.
Molecular Properties
| Compound Name | 3-ethoxyisoquinoline |
| PubChem CID | 640966 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 3-ethoxyisoquinoline |
| SMILES | CCOc1cc2ccccc2cn1 |
| InChI | InChI=1S/C11H11NO/c1-2-13-11-7-9-5-3-4-6-10(9)8-12-11/h3-8H,2H2,1H3 |
| InChIKey | IZPZUGQJVNFYLH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxyisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxyisoquinoline?
The IUPAC name of 3-ethoxyisoquinoline (CID 640966) is 3-ethoxyisoquinoline.
What is the SMILES notation for 3-ethoxyisoquinoline?
The canonical SMILES for 3-ethoxyisoquinoline is CCOc1cc2ccccc2cn1.
What is the InChIKey of 3-ethoxyisoquinoline?
The InChIKey is IZPZUGQJVNFYLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-2-13-11-7-9-5-3-4-6-10(9)8-12-11/h3-8H,2H2,1H3.
What are the key properties of 3-ethoxyisoquinoline?
3-ethoxyisoquinoline has a molecular weight of 173.21 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxyisoquinoline is sourced from PubChem (CID 640966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).