C17H23Cl2N5O3 — CID 6410843
4-methyl-N-(2-morpholin-4-ylethyl)-6-(4-nitrophenyl)pyridazin-3-amine;dihydrochloride (PubChem CID 6410843) has the molecular formula C17H23Cl2N5O3 and a molecular weight of 416.31 g/mol. Its IUPAC name is 4-methyl-N-(2-morpholin-4-ylethyl)-6-(4-nitrophenyl)pyridazin-3-amine;dihydrochloride.
| Compound Name | 4-methyl-N-(2-morpholin-4-ylethyl)-6-(4-nitrophenyl)pyridazin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 6410843 |
| Molecular Formula | C17H23Cl2N5O3 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 4-methyl-N-(2-morpholin-4-ylethyl)-6-(4-nitrophenyl)pyridazin-3-amine;dihydrochloride |
| SMILES | Cc1cc(-c2ccc([N+](=O)[O-])cc2)nnc1NCCN1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C17H21N5O3.2ClH/c1-13-12-16(14-2-4-15(5-3-14)22(23)24)19-20-17(13)18-6-7-21-8-10-25-11-9-21;;/h2-5,12H,6-11H2,1H3,(H,18,20);2*1H |
| InChIKey | SJZBFTWJGIXDOU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|