C17H23N5 — CID 59867380
4-methyl-6-phenyl-N-(2-piperazin-1-ylethyl)pyridazin-3-amine (PubChem CID 59867380) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is 4-methyl-6-phenyl-N-(2-piperazin-1-ylethyl)pyridazin-3-amine.
| Compound Name | 4-methyl-6-phenyl-N-(2-piperazin-1-ylethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 59867380 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 4-methyl-6-phenyl-N-(2-piperazin-1-ylethyl)pyridazin-3-amine |
| SMILES | Cc1cc(-c2ccccc2)nnc1NCCN1CCNCC1 |
| InChI | InChI=1S/C17H23N5/c1-14-13-16(15-5-3-2-4-6-15)20-21-17(14)19-9-12-22-10-7-18-8-11-22/h2-6,13,18H,7-12H2,1H3,(H,19,21) |
| InChIKey | DSULVDIIXDFKIC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |