C14H19N5 — CID 82514067
1-[2-(3-phenyl-1,2,4-triazol-4-yl)ethyl]piperazine (PubChem CID 82514067) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-[2-(3-phenyl-1,2,4-triazol-4-yl)ethyl]piperazine.
| Compound Name | 1-[2-(3-phenyl-1,2,4-triazol-4-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 82514067 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-[2-(3-phenyl-1,2,4-triazol-4-yl)ethyl]piperazine |
| SMILES | c1ccc(-c2nncn2CCN2CCNCC2)cc1 |
| InChI | InChI=1S/C14H19N5/c1-2-4-13(5-3-1)14-17-16-12-19(14)11-10-18-8-6-15-7-9-18/h1-5,12,15H,6-11H2 |
| InChIKey | PUACWHSTJXULMM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |