C20H17N5O3S2 — CID 6412093
2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 6412093) has the molecular formula C20H17N5O3S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 6412093 |
| Molecular Formula | C20H17N5O3S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | O=C(CSc1nnc(-c2ccco2)c(-c2ccco2)n1)Nc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C20H17N5O3S2/c26-16(22-19-21-12-5-1-2-8-15(12)30-19)11-29-20-23-17(13-6-3-9-27-13)18(24-25-20)14-7-4-10-28-14/h3-4,6-7,9-10H,1-2,5,8,11H2,(H,21,22,26) |
| InChIKey | KGICMUKXCFTNSQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'} |
|---|