C12H12N2O4 — CID 6412150
(E,2Z)-N-hydroxy-2-hydroxyimino-4-oxo-6-phenylhex-5-enamide (PubChem CID 6412150) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is (E,2Z)-N-hydroxy-2-hydroxyimino-4-oxo-6-phenylhex-5-enamide.
| Compound Name | (E,2Z)-N-hydroxy-2-hydroxyimino-4-oxo-6-phenylhex-5-enamide |
|---|---|
| PubChem CID | 6412150 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (E,2Z)-N-hydroxy-2-hydroxyimino-4-oxo-6-phenylhex-5-enamide |
| SMILES | O=C(/C=C/c1ccccc1)C/C(=N/O)C(=O)NO |
| InChI | InChI=1S/C12H12N2O4/c15-10(8-11(13-17)12(16)14-18)7-6-9-4-2-1-3-5-9/h1-7,17-18H,8H2,(H,14,16)/b7-6+,13-11- |
| InChIKey | CPDQYBLQNONGSD-UJSHDLROSA-N |
| XLogP | 0.99 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|