C28H28N4O4 — CID 6413403
methyl 4-[[4-[4-[2-(diethylamino)-2-oxoethoxy]phenyl]phthalazin-1-yl]amino]benzoate (PubChem CID 6413403) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is methyl 4-[[4-[4-[2-(diethylamino)-2-oxoethoxy]phenyl]phthalazin-1-yl]amino]benzoate.
| Compound Name | methyl 4-[[4-[4-[2-(diethylamino)-2-oxoethoxy]phenyl]phthalazin-1-yl]amino]benzoate |
|---|---|
| PubChem CID | 6413403 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | methyl 4-[[4-[4-[2-(diethylamino)-2-oxoethoxy]phenyl]phthalazin-1-yl]amino]benzoate |
| SMILES | CCN(CC)C(=O)COc1ccc(-c2nnc(Nc3ccc(C(=O)OC)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H28N4O4/c1-4-32(5-2)25(33)18-36-22-16-12-19(13-17-22)26-23-8-6-7-9-24(23)27(31-30-26)29-21-14-10-20(11-15-21)28(34)35-3/h6-17H,4-5,18H2,1-3H3,(H,29,31) |
| InChIKey | QYEGIFLCBJVZAJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |