C23H19N3O2 — CID 56949020
methyl 4-[4-(3-methylanilino)phthalazin-1-yl]benzoate (PubChem CID 56949020) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl 4-[4-(3-methylanilino)phthalazin-1-yl]benzoate.
| Compound Name | methyl 4-[4-(3-methylanilino)phthalazin-1-yl]benzoate |
|---|---|
| PubChem CID | 56949020 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | methyl 4-[4-(3-methylanilino)phthalazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nnc(Nc3cccc(C)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H19N3O2/c1-15-6-5-7-18(14-15)24-22-20-9-4-3-8-19(20)21(25-26-22)16-10-12-17(13-11-16)23(27)28-2/h3-14H,1-2H3,(H,24,26) |
| InChIKey | DPIRMEPWAJRVSC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |