C21H19N5O3 — CID 88896529
methyl 3-(methoxyamino)-5-(3-methylanilino)pyrimido[4,5-c]quinoline-8-carboxylate (PubChem CID 88896529) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is methyl 3-(methoxyamino)-5-(3-methylanilino)pyrimido[4,5-c]quinoline-8-carboxylate.
| Compound Name | methyl 3-(methoxyamino)-5-(3-methylanilino)pyrimido[4,5-c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 88896529 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | methyl 3-(methoxyamino)-5-(3-methylanilino)pyrimido[4,5-c]quinoline-8-carboxylate |
| SMILES | CONc1ncc2c(n1)c(Nc1cccc(C)c1)nc1cc(C(=O)OC)ccc12 |
| InChI | InChI=1S/C21H19N5O3/c1-12-5-4-6-14(9-12)23-19-18-16(11-22-21(25-18)26-29-3)15-8-7-13(20(27)28-2)10-17(15)24-19/h4-11H,1-3H3,(H,23,24)(H,22,25,26) |
| InChIKey | IATVYEQVBYYMIM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|