C30H24N4OS — CID 6414091
N-benzhydryl-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]acetamide (PubChem CID 6414091) has the molecular formula C30H24N4OS and a molecular weight of 488.62 g/mol. Its IUPAC name is N-benzhydryl-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]acetamide.
| Compound Name | N-benzhydryl-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 6414091 |
| Molecular Formula | C30H24N4OS |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N-benzhydryl-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)c(-c2ccccc2)n1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H24N4OS/c35-26(31-27(22-13-5-1-6-14-22)23-15-7-2-8-16-23)21-36-30-32-28(24-17-9-3-10-18-24)29(33-34-30)25-19-11-4-12-20-25/h1-20,27H,21H2,(H,31,35) |
| InChIKey | BTONNBLRGDBZNX-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |