C18H18N6OS — CID 7810110
N-benzhydryl-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]acetamide (PubChem CID 7810110) has the molecular formula C18H18N6OS and a molecular weight of 366.45 g/mol. Its IUPAC name is N-benzhydryl-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]acetamide.
| Compound Name | N-benzhydryl-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 7810110 |
| Molecular Formula | C18H18N6OS |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N-benzhydryl-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]acetamide |
| SMILES | Nc1nc(N)nc(SCC(=O)NC(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C18H18N6OS/c19-16-22-17(20)24-18(23-16)26-11-14(25)21-15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2,(H,21,25)(H4,19,20,22,23,24) |
| InChIKey | ARDWHQMYFVNSDR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |