C20H21N3O — CID 6414356
2,6-dimethyl-4-(4-phenylphthalazin-1-yl)morpholine (PubChem CID 6414356) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 2,6-dimethyl-4-(4-phenylphthalazin-1-yl)morpholine.
| Compound Name | 2,6-dimethyl-4-(4-phenylphthalazin-1-yl)morpholine |
|---|---|
| PubChem CID | 6414356 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 2,6-dimethyl-4-(4-phenylphthalazin-1-yl)morpholine |
| SMILES | CC1CN(c2nnc(-c3ccccc3)c3ccccc23)CC(C)O1 |
| InChI | InChI=1S/C20H21N3O/c1-14-12-23(13-15(2)24-14)20-18-11-7-6-10-17(18)19(21-22-20)16-8-4-3-5-9-16/h3-11,14-15H,12-13H2,1-2H3 |
| InChIKey | XMYLUYJMMPSMNS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |