C10H16ClN4+ — CID 6418933
3-chloro-6-(4,4-dimethylpiperazin-4-ium-1-yl)pyridazine (PubChem CID 6418933) has the molecular formula C10H16ClN4+ and a molecular weight of 227.72 g/mol. Its IUPAC name is 3-chloro-6-(4,4-dimethylpiperazin-4-ium-1-yl)pyridazine.
| Compound Name | 3-chloro-6-(4,4-dimethylpiperazin-4-ium-1-yl)pyridazine |
|---|---|
| PubChem CID | 6418933 |
| Molecular Formula | C10H16ClN4+ |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-chloro-6-(4,4-dimethylpiperazin-4-ium-1-yl)pyridazine |
| SMILES | C[N+]1(C)CCN(c2ccc(Cl)nn2)CC1 |
| InChI | InChI=1S/C10H16ClN4/c1-15(2)7-5-14(6-8-15)10-4-3-9(11)12-13-10/h3-4H,5-8H2,1-2H3/q+1 |
| InChIKey | NNCZVCVLBMARHS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|