C13H18F7NO3 — CID 6421031
propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-methylpentanoate (PubChem CID 6421031) has the molecular formula C13H18F7NO3 and a molecular weight of 369.28 g/mol. Its IUPAC name is propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-methylpentanoate.
| Compound Name | propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-methylpentanoate |
|---|---|
| PubChem CID | 6421031 |
| Molecular Formula | C13H18F7NO3 |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-methylpentanoate |
| SMILES | CCCOC(=O)C(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(C)CC |
| InChI | InChI=1S/C13H18F7NO3/c1-4-6-24-9(22)8(7(3)5-2)21-10(23)11(14,15)12(16,17)13(18,19)20/h7-8H,4-6H2,1-3H3,(H,21,23) |
| InChIKey | DUFVIJNGFUKOEC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|