C8H5ClI2 — CID 6422982
1-chloro-4-(2,2-diiodoethenyl)benzene (PubChem CID 6422982) has the molecular formula C8H5ClI2 and a molecular weight of 390.39 g/mol. Its IUPAC name is 1-chloro-4-(2,2-diiodoethenyl)benzene.
| Compound Name | 1-chloro-4-(2,2-diiodoethenyl)benzene |
|---|---|
| PubChem CID | 6422982 |
| Molecular Formula | C8H5ClI2 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 389.82 |
| IUPAC Name | 1-chloro-4-(2,2-diiodoethenyl)benzene |
| SMILES | Clc1ccc(C=C(I)I)cc1 |
| InChI | InChI=1S/C8H5ClI2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-5H |
| InChIKey | HZYXGJOCBOJUPD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|