C20H21ClO4 — CID 6423782
1-O-(4-chloro-3-methylphenyl) 2-O-pentan-2-yl benzene-1,2-dicarboxylate (PubChem CID 6423782) has the molecular formula C20H21ClO4 and a molecular weight of 360.84 g/mol. Its IUPAC name is 1-O-(4-chloro-3-methylphenyl) 2-O-pentan-2-yl benzene-1,2-dicarboxylate.
| Compound Name | 1-O-(4-chloro-3-methylphenyl) 2-O-pentan-2-yl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6423782 |
| Molecular Formula | C20H21ClO4 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1-O-(4-chloro-3-methylphenyl) 2-O-pentan-2-yl benzene-1,2-dicarboxylate |
| SMILES | CCCC(C)OC(=O)c1ccccc1C(=O)Oc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C20H21ClO4/c1-4-7-14(3)24-19(22)16-8-5-6-9-17(16)20(23)25-15-10-11-18(21)13(2)12-15/h5-6,8-12,14H,4,7H2,1-3H3 |
| InChIKey | MOPXLVPKMRZOMT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|