C25H40O5 — CID 6424115
1-O-hexyl 2-O-[3-(2-methoxyethyl)octyl] benzene-1,2-dicarboxylate (PubChem CID 6424115) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is 1-O-hexyl 2-O-[3-(2-methoxyethyl)octyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-hexyl 2-O-[3-(2-methoxyethyl)octyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6424115 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 1-O-hexyl 2-O-[3-(2-methoxyethyl)octyl] benzene-1,2-dicarboxylate |
| SMILES | CCCCCCOC(=O)c1ccccc1C(=O)OCCC(CCCCC)CCOC |
| InChI | InChI=1S/C25H40O5/c1-4-6-8-12-18-29-24(26)22-14-10-11-15-23(22)25(27)30-20-17-21(16-19-28-3)13-9-7-5-2/h10-11,14-15,21H,4-9,12-13,16-20H2,1-3H3 |
| InChIKey | QDJFQXJUMVOAIQ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|