C21H16ClF3N4O — CID 6426147
N-[2-(4-chlorophenyl)ethyl]-9-methoxy-5-(trifluoromethyl)pyrimido[5,4-c]quinolin-4-amine (PubChem CID 6426147) has the molecular formula C21H16ClF3N4O and a molecular weight of 432.83 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-9-methoxy-5-(trifluoromethyl)pyrimido[5,4-c]quinolin-4-amine.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-9-methoxy-5-(trifluoromethyl)pyrimido[5,4-c]quinolin-4-amine |
|---|---|
| PubChem CID | 6426147 |
| Molecular Formula | C21H16ClF3N4O |
| Molecular Weight | 432.83 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-9-methoxy-5-(trifluoromethyl)pyrimido[5,4-c]quinolin-4-amine |
| SMILES | COc1ccc2nc(C(F)(F)F)c3c(NCCc4ccc(Cl)cc4)ncnc3c2c1 |
| InChI | InChI=1S/C21H16ClF3N4O/c1-30-14-6-7-16-15(10-14)18-17(19(29-16)21(23,24)25)20(28-11-27-18)26-9-8-12-2-4-13(22)5-3-12/h2-7,10-11H,8-9H2,1H3,(H,26,27,28) |
| InChIKey | OJRVMJYQWFXXDJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.83 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|