C24H43BO5 — CID 6427174
7-[(1R,5S,6R,7R)-3-butyl-7-[(E,3S)-3-hydroxyoct-1-enyl]-2,4-dioxa-3-borabicyclo[3.2.1]octan-6-yl]heptanoic acid (PubChem CID 6427174) has the molecular formula C24H43BO5 and a molecular weight of 422.42 g/mol. Its IUPAC name is 7-[(1R,5S,6R,7R)-3-butyl-7-[(E,3S)-3-hydroxyoct-1-enyl]-2,4-dioxa-3-borabicyclo[3.2.1]octan-6-yl]heptanoic acid.
| Compound Name | 7-[(1R,5S,6R,7R)-3-butyl-7-[(E,3S)-3-hydroxyoct-1-enyl]-2,4-dioxa-3-borabicyclo[3.2.1]octan-6-yl]heptanoic acid |
|---|---|
| PubChem CID | 6427174 |
| Molecular Formula | C24H43BO5 |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | 7-[(1R,5S,6R,7R)-3-butyl-7-[(E,3S)-3-hydroxyoct-1-enyl]-2,4-dioxa-3-borabicyclo[3.2.1]octan-6-yl]heptanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](CCCCCCC(=O)O)[C@@H]2C[C@H]1OB(CCCC)O2 |
| InChI | InChI=1S/C24H43BO5/c1-3-5-9-12-19(26)15-16-21-20(13-10-7-8-11-14-24(27)28)22-18-23(21)30-25(29-22)17-6-4-2/h15-16,19-23,26H,3-14,17-18H2,1-2H3,(H,27,28)/b16-15+/t19-,20+,21+,22-,23+/m0/s1 |
| InChIKey | JVRQPYYICMNSEK-ZMTVCQQHSA-N |
| XLogP | 5.62 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|