C31H50O2 — CID 6427309
[(4S,5S)-17-[(E)-5,6-dimethylhept-4-en-2-yl]-4,10,13-trimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 6427309) has the molecular formula C31H50O2 and a molecular weight of 454.74 g/mol. Its IUPAC name is [(4S,5S)-17-[(E)-5,6-dimethylhept-4-en-2-yl]-4,10,13-trimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(4S,5S)-17-[(E)-5,6-dimethylhept-4-en-2-yl]-4,10,13-trimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 6427309 |
| Molecular Formula | C31H50O2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | [(4S,5S)-17-[(E)-5,6-dimethylhept-4-en-2-yl]-4,10,13-trimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C3CCC4(C)C(CCC4C(C)C/C=C(\C)C(C)C)C3=CC[C@H]2[C@@H]1C |
| InChI | InChI=1S/C31H50O2/c1-19(2)20(3)9-10-21(4)25-13-14-27-24-11-12-26-22(5)29(33-23(6)32)16-18-31(26,8)28(24)15-17-30(25,27)7/h9,11,19,21-22,25-29H,10,12-18H2,1-8H3/b20-9+/t21?,22-,25?,26-,27?,28?,29?,30?,31?/m0/s1 |
| InChIKey | ORXXECLZMPJQFD-YGUMCWOCSA-N |
| XLogP | 8.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|