C30H48O2 — CID 20837663
[(8S,9S,10R,13R,14S,17R)-17-[(E,2R)-5,6-dimethylhept-4-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate (PubChem CID 20837663) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is [(8S,9S,10R,13R,14S,17R)-17-[(E,2R)-5,6-dimethylhept-4-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate.
| Compound Name | [(8S,9S,10R,13R,14S,17R)-17-[(E,2R)-5,6-dimethylhept-4-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate |
|---|---|
| PubChem CID | 20837663 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | [(8S,9S,10R,13R,14S,17R)-17-[(E,2R)-5,6-dimethylhept-4-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate |
| SMILES | CC(=O)OC1CCCC2=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)C/C=C(\C)C(C)C)[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C30H48O2/c1-19(2)20(3)11-12-21(4)25-15-16-26-24-14-13-23-9-8-10-28(32-22(5)31)30(23,7)27(24)17-18-29(25,26)6/h11,13,19,21,24-28H,8-10,12,14-18H2,1-7H3/b20-11+/t21-,24+,25-,26+,27+,28?,29-,30+/m1/s1 |
| InChIKey | VGVQEFHPMYHHHN-DUSSHDQASA-N |
| XLogP | 8.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|