C29H48O4 — CID 13178927
[(1R,2R,3R,8S,9S,10R,13R,14S,17R)-1,2-dihydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 13178927) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is [(1R,2R,3R,8S,9S,10R,13R,14S,17R)-1,2-dihydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(1R,2R,3R,8S,9S,10R,13R,14S,17R)-1,2-dihydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 13178927 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | [(1R,2R,3R,8S,9S,10R,13R,14S,17R)-1,2-dihydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC2=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]3[C@@]2(C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C29H48O4/c1-17(2)8-7-9-18(3)22-12-13-23-21-11-10-20-16-25(33-19(4)30)26(31)27(32)29(20,6)24(21)14-15-28(22,23)5/h10,17-18,21-27,31-32H,7-9,11-16H2,1-6H3/t18-,21+,22-,23+,24+,25-,26+,27+,28-,29+/m1/s1 |
| InChIKey | TVFLMXBRFNAULV-VIWILYPGSA-N |
| XLogP | 5.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|