C17H28F3NO4Si2 — CID 6427696
2,2,2-trifluoro-N-[2-(4-methoxy-3-trimethylsilyloxyphenyl)-2-trimethylsilyloxyethyl]acetamide (PubChem CID 6427696) has the molecular formula C17H28F3NO4Si2 and a molecular weight of 423.58 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(4-methoxy-3-trimethylsilyloxyphenyl)-2-trimethylsilyloxyethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(4-methoxy-3-trimethylsilyloxyphenyl)-2-trimethylsilyloxyethyl]acetamide |
|---|---|
| PubChem CID | 6427696 |
| Molecular Formula | C17H28F3NO4Si2 |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(4-methoxy-3-trimethylsilyloxyphenyl)-2-trimethylsilyloxyethyl]acetamide |
| SMILES | COc1ccc(C(CNC(=O)C(F)(F)F)O[Si](C)(C)C)cc1O[Si](C)(C)C |
| InChI | InChI=1S/C17H28F3NO4Si2/c1-23-13-9-8-12(10-14(13)24-26(2,3)4)15(25-27(5,6)7)11-21-16(22)17(18,19)20/h8-10,15H,11H2,1-7H3,(H,21,22) |
| InChIKey | WXBNDUVLOQIRSJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|