C24H24F12O11 — CID 6428167
[(2R,3R,4S,5R,6S)-6-[2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]propan-2-yloxy]-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate (PubChem CID 6428167) has the molecular formula C24H24F12O11 and a molecular weight of 716.42 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-[2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]propan-2-yloxy]-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-[2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]propan-2-yloxy]-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 6428167 |
| Molecular Formula | C24H24F12O11 |
| Molecular Weight | 716.42 g/mol |
| Exact Mass | 716.11 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-[2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]propan-2-yloxy]-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate |
| SMILES | C=C[C@@]1(C)CC[C@@H](C(C)(C)O[C@@H]2O[C@H](COC(=O)C(F)(F)F)[C@@H](OC(=O)C(F)(F)F)[C@H](OC(=O)C(F)(F)F)[C@H]2OC(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C24H24F12O11/c1-5-20(4)7-6-10(46-20)19(2,3)47-14-13(45-18(40)24(34,35)36)12(44-17(39)23(31,32)33)11(43-16(38)22(28,29)30)9(42-14)8-41-15(37)21(25,26)27/h5,9-14H,1,6-8H2,2-4H3/t9-,10+,11-,12+,13-,14+,20+/m1/s1 |
| InChIKey | WJLOKMGYFMOJBB-PRBJLGQQSA-N |
| XLogP | 4.16 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|