C10H16O2 — CID 6428761
(2Z)-2-(3,3-dimethylcyclohexylidene)acetic acid (PubChem CID 6428761) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (2Z)-2-(3,3-dimethylcyclohexylidene)acetic acid.
| Compound Name | (2Z)-2-(3,3-dimethylcyclohexylidene)acetic acid |
|---|---|
| PubChem CID | 6428761 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (2Z)-2-(3,3-dimethylcyclohexylidene)acetic acid |
| SMILES | CC1(C)CCC/C(=C/C(=O)O)C1 |
| InChI | InChI=1S/C10H16O2/c1-10(2)5-3-4-8(7-10)6-9(11)12/h6H,3-5,7H2,1-2H3,(H,11,12)/b8-6- |
| InChIKey | LKJIOHQBVGRPCO-VURMDHGXSA-N |
| XLogP | 2.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|