C8H18O4S2 — CID 6433
View drug profile → methylsulfonal2,2-bis(ethylsulfonyl)butane (PubChem CID 6433) has the molecular formula C8H18O4S2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2,2-bis(ethylsulfonyl)butane.
| Compound Name | 2,2-bis(ethylsulfonyl)butane |
|---|---|
| PubChem CID | 6433 |
| Molecular Formula | C8H18O4S2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2,2-bis(ethylsulfonyl)butane |
| SMILES | CCC(C)(S(=O)(=O)CC)S(=O)(=O)CC |
| InChI | InChI=1S/C8H18O4S2/c1-5-8(4,13(9,10)6-2)14(11,12)7-3/h5-7H2,1-4H3 |
| InChIKey | LKACJLUUJRMGFK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |