C8H16O4S2 — CID 2829782
3-butylsulfonylthiolane 1,1-dioxide (PubChem CID 2829782) has the molecular formula C8H16O4S2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-butylsulfonylthiolane 1,1-dioxide.
| Compound Name | 3-butylsulfonylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 2829782 |
| Molecular Formula | C8H16O4S2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 3-butylsulfonylthiolane 1,1-dioxide |
| SMILES | CCCCS(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H16O4S2/c1-2-3-5-14(11,12)8-4-6-13(9,10)7-8/h8H,2-7H2,1H3 |
| InChIKey | RQJLVZQHCOGGSA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |