C20H21N3O — CID 6433090
View drug profile → imidafenacin4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide (PubChem CID 6433090) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide.
| Compound Name | 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide |
|---|---|
| PubChem CID | 6433090 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide |
| SMILES | Cc1nccn1CCC(C(N)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O/c1-16-22-13-15-23(16)14-12-20(19(21)24,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,13,15H,12,14H2,1H3,(H2,21,24) |
| InChIKey | SQKXYSGRELMAAU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |