C22H21IN2S — CID 6433478
N,N-dimethyl-4-[(E)-2-(1-methylbenzo[e][1,3]benzothiazol-1-ium-2-yl)ethenyl]aniline iodide (PubChem CID 6433478) has the molecular formula C22H21IN2S and a molecular weight of 472.40 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-(1-methylbenzo[e][1,3]benzothiazol-1-ium-2-yl)ethenyl]aniline iodide.
| Compound Name | N,N-dimethyl-4-[(E)-2-(1-methylbenzo[e][1,3]benzothiazol-1-ium-2-yl)ethenyl]aniline iodide |
|---|---|
| PubChem CID | 6433478 |
| Molecular Formula | C22H21IN2S |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-(1-methylbenzo[e][1,3]benzothiazol-1-ium-2-yl)ethenyl]aniline iodide |
| SMILES | CN(C)c1ccc(/C=C/c2sc3ccc4ccccc4c3[n+]2C)cc1.[I-] |
| InChI | InChI=1S/C22H21N2S.HI/c1-23(2)18-12-8-16(9-13-18)10-15-21-24(3)22-19-7-5-4-6-17(19)11-14-20(22)25-21;/h4-15H,1-3H3;1H/q+1;/p-1 |
| InChIKey | IKAPOHKDZVIPFQ-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|