About (7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate
(7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate (PubChem CID 6434042) has the molecular formula C20H16N2O4
and a molecular weight of 348.36 g/mol. Its IUPAC name is (7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate.
Molecular Properties
| Compound Name | (7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate |
| PubChem CID | 6434042 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate |
| SMILES | CC/C(=C\c1ccccc1)C(=O)Oc1c([N+](=O)[O-])ccc2cccnc12 |
| InChI | InChI=1S/C20H16N2O4/c1-2-15(13-14-7-4-3-5-8-14)20(23)26-19-17(22(24)25)11-10-16-9-6-12-21-18(16)19/h3-13H,2H2,1H3/b15-13+ |
| InChIKey | ZMXQHSVNMQOTDB-FYWRMAATSA-N |
| XLogP | 4.54 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate?
The IUPAC name of (7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate (CID 6434042) is (7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate.
What is the SMILES notation for (7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate?
The canonical SMILES for (7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate is CC/C(=C\c1ccccc1)C(=O)Oc1c([N+](=O)[O-])ccc2cccnc12.
What is the InChIKey of (7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate?
The InChIKey is ZMXQHSVNMQOTDB-FYWRMAATSA-N. The full InChI is InChI=1S/C20H16N2O4/c1-2-15(13-14-7-4-3-5-8-14)20(23)26-19-17(22(24)25)11-10-16-9-6-12-21-18(16)19/h3-13H,2H2,1H3/b15-13+.
What are the key properties of (7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate?
(7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate has a molecular weight of 348.36 g/mol, XLogP of 4.54, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-nitroquinolin-8-yl) (2E)-2-benzylidenebutanoate is sourced from PubChem (CID 6434042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).