C26H27N3O8S — CID 6434358
bis((Z)-but-2-enedioic acid);6-(4-methylpiperazin-1-yl)-[1]benzothiepino[2,3-b]pyridine (PubChem CID 6434358) has the molecular formula C26H27N3O8S and a molecular weight of 541.58 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);6-(4-methylpiperazin-1-yl)-[1]benzothiepino[2,3-b]pyridine.
| Compound Name | bis((Z)-but-2-enedioic acid);6-(4-methylpiperazin-1-yl)-[1]benzothiepino[2,3-b]pyridine |
|---|---|
| PubChem CID | 6434358 |
| Molecular Formula | C26H27N3O8S |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);6-(4-methylpiperazin-1-yl)-[1]benzothiepino[2,3-b]pyridine |
| SMILES | CN1CCN(C2=Cc3cccnc3Sc3ccccc32)CC1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H19N3S.2C4H4O4/c1-20-9-11-21(12-10-20)16-13-14-5-4-8-19-18(14)22-17-7-3-2-6-15(16)17;2*5-3(6)1-2-4(7)8/h2-8,13H,9-12H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | OTMBNUYEODQFKV-SPIKMXEPSA-N |
| XLogP | 2.72 |
| TPSA | 168.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|