C19H18ClFN2S — CID 3045477
1-(2-chloro-3-fluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine (PubChem CID 3045477) has the molecular formula C19H18ClFN2S and a molecular weight of 360.89 g/mol. Its IUPAC name is 1-(2-chloro-3-fluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine.
| Compound Name | 1-(2-chloro-3-fluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 3045477 |
| Molecular Formula | C19H18ClFN2S |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 1-(2-chloro-3-fluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine |
| SMILES | CN1CCN(C2=Cc3ccccc3Sc3cc(Cl)c(F)cc32)CC1 |
| InChI | InChI=1S/C19H18ClFN2S/c1-22-6-8-23(9-7-22)17-10-13-4-2-3-5-18(13)24-19-12-15(20)16(21)11-14(17)19/h2-5,10-12H,6-9H2,1H3 |
| InChIKey | VZYQAZQZCXHQLY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_ene_A(8)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|