C22H20ClN3 — CID 57126010
2-[7-chloro-10-(4-methylpiperazin-1-yl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]acetonitrile (PubChem CID 57126010) has the molecular formula C22H20ClN3 and a molecular weight of 361.88 g/mol. Its IUPAC name is 2-[7-chloro-10-(4-methylpiperazin-1-yl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]acetonitrile.
| Compound Name | 2-[7-chloro-10-(4-methylpiperazin-1-yl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]acetonitrile |
|---|---|
| PubChem CID | 57126010 |
| Molecular Formula | C22H20ClN3 |
| Molecular Weight | 361.88 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-[7-chloro-10-(4-methylpiperazin-1-yl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]acetonitrile |
| SMILES | CN1CCN(C2=Cc3c(Cl)cccc3C(=CC#N)c3ccccc32)CC1 |
| InChI | InChI=1S/C22H20ClN3/c1-25-11-13-26(14-12-25)22-15-20-17(7-4-8-21(20)23)18(9-10-24)16-5-2-3-6-19(16)22/h2-9,15H,11-14H2,1H3 |
| InChIKey | UQBOHSPASSWFJF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.88 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|