C21H23ClN2O — CID 91824384
1-(8-chloro-4-phenyl-2,3-dihydro-1-benzoxepin-5-yl)-4-methylpiperazine (PubChem CID 91824384) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is 1-(8-chloro-4-phenyl-2,3-dihydro-1-benzoxepin-5-yl)-4-methylpiperazine.
| Compound Name | 1-(8-chloro-4-phenyl-2,3-dihydro-1-benzoxepin-5-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 91824384 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-(8-chloro-4-phenyl-2,3-dihydro-1-benzoxepin-5-yl)-4-methylpiperazine |
| SMILES | CN1CCN(C2=C(c3ccccc3)CCOc3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C21H23ClN2O/c1-23-10-12-24(13-11-23)21-18(16-5-3-2-4-6-16)9-14-25-20-15-17(22)7-8-19(20)21/h2-8,15H,9-14H2,1H3 |
| InChIKey | SPXBBOSHJBXQGM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|