C13H16ClN3O — CID 70590951
7-chloro-2-(4-methylpiperazin-1-yl)-4H-1,3-benzoxazine (PubChem CID 70590951) has the molecular formula C13H16ClN3O and a molecular weight of 265.74 g/mol. Its IUPAC name is 7-chloro-2-(4-methylpiperazin-1-yl)-4H-1,3-benzoxazine.
| Compound Name | 7-chloro-2-(4-methylpiperazin-1-yl)-4H-1,3-benzoxazine |
|---|---|
| PubChem CID | 70590951 |
| Molecular Formula | C13H16ClN3O |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 7-chloro-2-(4-methylpiperazin-1-yl)-4H-1,3-benzoxazine |
| SMILES | CN1CCN(C2=NCc3ccc(Cl)cc3O2)CC1 |
| InChI | InChI=1S/C13H16ClN3O/c1-16-4-6-17(7-5-16)13-15-9-10-2-3-11(14)8-12(10)18-13/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | UYBINUSVPNLYNK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |