C20H27NO4 — CID 6435465
1-[(2Z)-2-benzylidenecyclohexyl]azetidine;butanedioic acid (PubChem CID 6435465) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-[(2Z)-2-benzylidenecyclohexyl]azetidine;butanedioic acid.
| Compound Name | 1-[(2Z)-2-benzylidenecyclohexyl]azetidine;butanedioic acid |
|---|---|
| PubChem CID | 6435465 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-[(2Z)-2-benzylidenecyclohexyl]azetidine;butanedioic acid |
| SMILES | C(=C1/CCCCC1N1CCC1)\c1ccccc1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C16H21N.C4H6O4/c1-2-7-14(8-3-1)13-15-9-4-5-10-16(15)17-11-6-12-17;5-3(6)1-2-4(7)8/h1-3,7-8,13,16H,4-6,9-12H2;1-2H2,(H,5,6)(H,7,8)/b15-13-; |
| InChIKey | IEXXCIWKNWOEKZ-ZDCVYKBASA-N |
| XLogP | 3.65 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |