About 1-iodo-4-nitrosobenzene
1-iodo-4-nitrosobenzene (PubChem CID 643580) has the molecular formula C6H4INO
and a molecular weight of 233.01 g/mol. Its IUPAC name is 1-iodo-4-nitrosobenzene.
Molecular Properties
| Compound Name | 1-iodo-4-nitrosobenzene |
| PubChem CID | 643580 |
| Molecular Formula | C6H4INO |
| Molecular Weight | 233.01 g/mol |
| Exact Mass | 232.93 |
| IUPAC Name | 1-iodo-4-nitrosobenzene |
| SMILES | O=Nc1ccc(I)cc1 |
| InChI | InChI=1S/C6H4INO/c7-5-1-3-6(8-9)4-2-5/h1-4H |
| InChIKey | OORNJEMTTOSEKE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.01 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-4-nitrosobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-4-nitrosobenzene?
The IUPAC name of 1-iodo-4-nitrosobenzene (CID 643580) is 1-iodo-4-nitrosobenzene.
What is the SMILES notation for 1-iodo-4-nitrosobenzene?
The canonical SMILES for 1-iodo-4-nitrosobenzene is O=Nc1ccc(I)cc1.
What is the InChIKey of 1-iodo-4-nitrosobenzene?
The InChIKey is OORNJEMTTOSEKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4INO/c7-5-1-3-6(8-9)4-2-5/h1-4H.
What are the key properties of 1-iodo-4-nitrosobenzene?
1-iodo-4-nitrosobenzene has a molecular weight of 233.01 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-4-nitrosobenzene is sourced from PubChem (CID 643580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).