About Sclerotiorin
Sclerotiorin (PubChem CID 6436015) has the molecular formula C21H23ClO5
and a molecular weight of 390.90 g/mol. Its IUPAC name is [(7R)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-7-methyl-6,8-dioxoisochromen-7-yl] acetate.
Molecular Properties
| Compound Name | Sclerotiorin |
| PubChem CID | 6436015 |
| Molecular Formula | C21H23ClO5 |
| Molecular Weight | 390.90 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [(7R)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-7-methyl-6,8-dioxoisochromen-7-yl] acetate |
| SMILES | CC[C@H](C)/C=C(\C)/C=C/C1=CC2=C(C(=O)[C@](C(=O)C2=CO1)(C)OC(=O)C)Cl |
| InChI | InChI=1S/C21H23ClO5/c1-6-12(2)9-13(3)7-8-15-10-16-17(11-26-15)19(24)21(5,27-14(4)23)20(25)18(16)22/h7-12H,6H2,1-5H3/b8-7+,13-9+/t12-,21+/m0/s1 |
| InChIKey | SWJLTKXURNHVHE-UPWXJBBJSA-N |
| XLogP | 4.80 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | 841 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.90 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze Sclerotiorin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sclerotiorin?
The IUPAC name of Sclerotiorin (CID 6436015) is [(7R)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-7-methyl-6,8-dioxoisochromen-7-yl] acetate.
What is the SMILES notation for Sclerotiorin?
The canonical SMILES for Sclerotiorin is CC[C@H](C)/C=C(\C)/C=C/C1=CC2=C(C(=O)[C@](C(=O)C2=CO1)(C)OC(=O)C)Cl.
What is the InChIKey of Sclerotiorin?
The InChIKey is SWJLTKXURNHVHE-UPWXJBBJSA-N. The full InChI is InChI=1S/C21H23ClO5/c1-6-12(2)9-13(3)7-8-15-10-16-17(11-26-15)19(24)21(5,27-14(4)23)20(25)18(16)22/h7-12H,6H2,1-5H3/b8-7+,13-9+/t12-,21+/m0/s1.
What are the key properties of Sclerotiorin?
Sclerotiorin has a molecular weight of 390.90 g/mol, XLogP of 4.80, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Sclerotiorin is sourced from PubChem (CID 6436015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).