C14H24O — CID 6437442
(E)-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-ol (PubChem CID 6437442) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (E)-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-ol.
| Compound Name | (E)-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-ol |
|---|---|
| PubChem CID | 6437442 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (E)-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-ol |
| SMILES | CCC(O)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C14H24O/c1-5-12(15)8-9-13-11(2)7-6-10-14(13,3)4/h8-9,12,15H,5-7,10H2,1-4H3/b9-8+ |
| InChIKey | DZSNHSUUMHDJRJ-CMDGGOBGSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |