C26H52N2O5S — CID 6437562
diethyl sulfate;2-[2-[(E)-heptadec-8-enyl]-4,5-dihydroimidazol-1-yl]ethanol (PubChem CID 6437562) has the molecular formula C26H52N2O5S and a molecular weight of 504.78 g/mol. Its IUPAC name is diethyl sulfate;2-[2-[(E)-heptadec-8-enyl]-4,5-dihydroimidazol-1-yl]ethanol.
| Compound Name | diethyl sulfate;2-[2-[(E)-heptadec-8-enyl]-4,5-dihydroimidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 6437562 |
| Molecular Formula | C26H52N2O5S |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 504.36 |
| IUPAC Name | diethyl sulfate;2-[2-[(E)-heptadec-8-enyl]-4,5-dihydroimidazol-1-yl]ethanol |
| SMILES | CCCCCCCC/C=C/CCCCCCCC1=NCCN1CCO.CCOS(=O)(=O)OCC |
| InChI | InChI=1S/C22H42N2O.C4H10O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-23-18-19-24(22)20-21-25;1-3-7-9(5,6)8-4-2/h9-10,25H,2-8,11-21H2,1H3;3-4H2,1-2H3/b10-9+; |
| InChIKey | VZRKETAUDBGCTG-RRABGKBLSA-N |
| XLogP | 6.03 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|