C19H26N2O8 — CID 6438277
(Z)-but-2-enedioic acid;N-ethyl-N-[[3-[(4-nitrophenoxy)methyl]oxetan-3-yl]methyl]ethanamine (PubChem CID 6438277) has the molecular formula C19H26N2O8 and a molecular weight of 410.42 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-ethyl-N-[[3-[(4-nitrophenoxy)methyl]oxetan-3-yl]methyl]ethanamine.
| Compound Name | (Z)-but-2-enedioic acid;N-ethyl-N-[[3-[(4-nitrophenoxy)methyl]oxetan-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 6438277 |
| Molecular Formula | C19H26N2O8 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-ethyl-N-[[3-[(4-nitrophenoxy)methyl]oxetan-3-yl]methyl]ethanamine |
| SMILES | CCN(CC)CC1(COc2ccc([N+](=O)[O-])cc2)COC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C15H22N2O4.C4H4O4/c1-3-16(4-2)9-15(10-20-11-15)12-21-14-7-5-13(6-8-14)17(18)19;5-3(6)1-2-4(7)8/h5-8H,3-4,9-12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | GYDNYDUXLAOLEL-BTJKTKAUSA-N |
| XLogP | 2.04 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|