About (3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione
(3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione (PubChem CID 6438683) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is (3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione.
Molecular Properties
| Compound Name | (3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione |
| PubChem CID | 6438683 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione |
| SMILES | C[C@@H]1CCCCCCC(=O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C12H18O3/c1-10-6-4-2-3-5-7-11(13)8-9-12(14)15-10/h8-10H,2-7H2,1H3/b9-8+/t10-/m1/s1 |
| InChIKey | XETYGXGLGYXEIT-AAXQSMANSA-N |
| XLogP | 2.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione?
The IUPAC name of (3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione (CID 6438683) is (3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione.
What is the SMILES notation for (3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione?
The canonical SMILES for (3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione is C[C@@H]1CCCCCCC(=O)/C=C/C(=O)O1.
What is the InChIKey of (3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione?
The InChIKey is XETYGXGLGYXEIT-AAXQSMANSA-N. The full InChI is InChI=1S/C12H18O3/c1-10-6-4-2-3-5-7-11(13)8-9-12(14)15-10/h8-10H,2-7H2,1H3/b9-8+/t10-/m1/s1.
What are the key properties of (3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione?
(3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione has a molecular weight of 210.27 g/mol, XLogP of 2.40, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione is sourced from PubChem (CID 6438683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).