C20H31FO2 — CID 6439507
(5E,8E,11E,14E)-20-(18F)fluoroicosa-5,8,11,14-tetraenoic acid (PubChem CID 6439507) has the molecular formula C20H31FO2 and a molecular weight of 321.47 g/mol. Its IUPAC name is (5E,8E,11E,14E)-20-(18F)fluoroicosa-5,8,11,14-tetraenoic acid.
| Compound Name | (5E,8E,11E,14E)-20-(18F)fluoroicosa-5,8,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 6439507 |
| Molecular Formula | C20H31FO2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | (5E,8E,11E,14E)-20-(18F)fluoroicosa-5,8,11,14-tetraenoic acid |
| SMILES | O=C(O)CCC/C=C/C/C=C/C/C=C/C/C=C/CCCCC[18F] |
| InChI | InChI=1S/C20H31FO2/c21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(22)23/h1,3-4,6-7,9-10,12H,2,5,8,11,13-19H2,(H,22,23)/b3-1+,6-4+,9-7+,12-10+/i21-1 |
| InChIKey | SYCLRLSYDSKRQU-RVMDOCBSSA-N |
| XLogP | 6.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|