C26H51NO5 — CID 6441546
(E)-N,N-bis[2-(2-hydroxyethoxy)ethyl]octadec-9-enamide (PubChem CID 6441546) has the molecular formula C26H51NO5 and a molecular weight of 457.70 g/mol. Its IUPAC name is (E)-N,N-bis[2-(2-hydroxyethoxy)ethyl]octadec-9-enamide.
| Compound Name | (E)-N,N-bis[2-(2-hydroxyethoxy)ethyl]octadec-9-enamide |
|---|---|
| PubChem CID | 6441546 |
| Molecular Formula | C26H51NO5 |
| Molecular Weight | 457.70 g/mol |
| Exact Mass | 457.38 |
| IUPAC Name | (E)-N,N-bis[2-(2-hydroxyethoxy)ethyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)N(CCOCCO)CCOCCO |
| InChI | InChI=1S/C26H51NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-26(30)27(18-22-31-24-20-28)19-23-32-25-21-29/h9-10,28-29H,2-8,11-25H2,1H3/b10-9+ |
| InChIKey | UOGNSJYISHZWQO-MDZDMXLPSA-N |
| XLogP | 4.87 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.70 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|