About dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one
dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one (PubChem CID 6441621) has the molecular formula C18H29NO5
and a molecular weight of 339.43 g/mol. Its IUPAC name is dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one |
| PubChem CID | 6441621 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one |
| SMILES | C=CN1CCCC1=O.CCCCOC(=O)/C=C\C(=O)OCCCC |
| InChI | InChI=1S/C12H20O4.C6H9NO/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2;1-2-7-5-3-4-6(7)8/h7-8H,3-6,9-10H2,1-2H3;2H,1,3-5H2/b8-7-; |
| InChIKey | VTSGZZHOICTQME-CFYXSCKTSA-N |
| XLogP | 2.98 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one?
The IUPAC name of dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one (CID 6441621) is dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one.
What is the SMILES notation for dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one?
The canonical SMILES for dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one is C=CN1CCCC1=O.CCCCOC(=O)/C=C\C(=O)OCCCC.
What is the InChIKey of dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one?
The InChIKey is VTSGZZHOICTQME-CFYXSCKTSA-N. The full InChI is InChI=1S/C12H20O4.C6H9NO/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2;1-2-7-5-3-4-6(7)8/h7-8H,3-6,9-10H2,1-2H3;2H,1,3-5H2/b8-7-;.
What are the key properties of dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one?
dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one has a molecular weight of 339.43 g/mol, XLogP of 2.98, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one is sourced from PubChem (CID 6441621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).