C19H34O2 — CID 6442716
(2S,3R,4aS,8aR)-3-methyl-2-[(E)-non-2-enyl]-2,4,4a,5,6,7,8,8a-octahydrochromen-3-ol (PubChem CID 6442716) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is (2S,3R,4aS,8aR)-3-methyl-2-[(E)-non-2-enyl]-2,4,4a,5,6,7,8,8a-octahydrochromen-3-ol.
| Compound Name | (2S,3R,4aS,8aR)-3-methyl-2-[(E)-non-2-enyl]-2,4,4a,5,6,7,8,8a-octahydrochromen-3-ol |
|---|---|
| PubChem CID | 6442716 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | (2S,3R,4aS,8aR)-3-methyl-2-[(E)-non-2-enyl]-2,4,4a,5,6,7,8,8a-octahydrochromen-3-ol |
| SMILES | CCCCCC/C=C/C[C@@H]1O[C@@H]2CCCC[C@H]2C[C@@]1(C)O |
| InChI | InChI=1S/C19H34O2/c1-3-4-5-6-7-8-9-14-18-19(2,20)15-16-12-10-11-13-17(16)21-18/h8-9,16-18,20H,3-7,10-15H2,1-2H3/b9-8+/t16-,17+,18-,19+/m0/s1 |
| InChIKey | NMDJFNHNYYFCIH-FDPUJYAVSA-N |
| XLogP | 5.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|