C20H30O — CID 6443383
(3Z,7Z,11E,14S)-3,7,11-trimethyl-14-prop-1-en-2-ylcyclotetradeca-3,7,11-trien-1-one (PubChem CID 6443383) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (3Z,7Z,11E,14S)-3,7,11-trimethyl-14-prop-1-en-2-ylcyclotetradeca-3,7,11-trien-1-one.
| Compound Name | (3Z,7Z,11E,14S)-3,7,11-trimethyl-14-prop-1-en-2-ylcyclotetradeca-3,7,11-trien-1-one |
|---|---|
| PubChem CID | 6443383 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (3Z,7Z,11E,14S)-3,7,11-trimethyl-14-prop-1-en-2-ylcyclotetradeca-3,7,11-trien-1-one |
| SMILES | C=C(C)[C@@H]1C/C=C(\C)CC/C=C(/C)CC/C=C(/C)CC1=O |
| InChI | InChI=1S/C20H30O/c1-15(2)19-13-12-17(4)10-6-8-16(3)9-7-11-18(5)14-20(19)21/h8,11-12,19H,1,6-7,9-10,13-14H2,2-5H3/b16-8-,17-12+,18-11-/t19-/m0/s1 |
| InChIKey | FHFFESCITRPPTG-XECYNXTNSA-N |
| XLogP | 5.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|