C12H18O3 — CID 6444101
(3Z,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione (PubChem CID 6444101) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (3Z,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione.
| Compound Name | (3Z,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione |
|---|---|
| PubChem CID | 6444101 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (3Z,12R)-12-methyl-1-oxacyclododec-3-ene-2,5-dione |
| SMILES | C[C@@H]1CCCCCCC(=O)/C=C\C(=O)O1 |
| InChI | InChI=1S/C12H18O3/c1-10-6-4-2-3-5-7-11(13)8-9-12(14)15-10/h8-10H,2-7H2,1H3/b9-8-/t10-/m1/s1 |
| InChIKey | XETYGXGLGYXEIT-HSTULFTRSA-N |
| XLogP | 2.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |